C17H13N3OS2 — CID 2705669
12-(1,3-benzothiazol-2-ylmethoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 2705669) has the molecular formula C17H13N3OS2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 12-(1,3-benzothiazol-2-ylmethoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-(1,3-benzothiazol-2-ylmethoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 2705669 |
| Molecular Formula | C17H13N3OS2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 12-(1,3-benzothiazol-2-ylmethoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | c1ccc2sc(COc3ncnc4sc5c(c34)CCC5)nc2c1 |
| InChI | InChI=1S/C17H13N3OS2/c1-2-6-13-11(5-1)20-14(22-13)8-21-16-15-10-4-3-7-12(10)23-17(15)19-9-18-16/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | UWBRBDWUXFALIF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |