C16H12Cl2N2OS — CID 4212632
12-[(2,4-dichlorophenyl)methoxy]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 4212632) has the molecular formula C16H12Cl2N2OS and a molecular weight of 351.26 g/mol. Its IUPAC name is 12-[(2,4-dichlorophenyl)methoxy]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-[(2,4-dichlorophenyl)methoxy]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 4212632 |
| Molecular Formula | C16H12Cl2N2OS |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 12-[(2,4-dichlorophenyl)methoxy]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | Clc1ccc(COc2ncnc3sc4c(c23)CCC4)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2OS/c17-10-5-4-9(12(18)6-10)7-21-15-14-11-2-1-3-13(11)22-16(14)20-8-19-15/h4-6,8H,1-3,7H2 |
| InChIKey | FHJKFBVHUZOCNU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |