C15H15ClOS — CID 79975052
5-[chloro-(3-ethylthiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 79975052) has the molecular formula C15H15ClOS and a molecular weight of 278.80 g/mol. Its IUPAC name is 5-[chloro-(3-ethylthiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[chloro-(3-ethylthiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 79975052 |
| Molecular Formula | C15H15ClOS |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 5-[chloro-(3-ethylthiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | CCc1ccsc1C(Cl)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H15ClOS/c1-2-10-6-8-18-15(10)14(16)12-3-4-13-11(9-12)5-7-17-13/h3-4,6,8-9,14H,2,5,7H2,1H3 |
| InChIKey | GTZMXBNTHQMMEX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|