About 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine
4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine (PubChem CID 79975298) has the molecular formula C15H12F2N2OS
and a molecular weight of 306.34 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine |
| PubChem CID | 79975298 |
| Molecular Formula | C15H12F2N2OS |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine |
| SMILES | CCc1ccsc1-c1onc(N)c1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H12F2N2OS/c1-2-8-3-4-21-14(8)13-12(15(18)19-20-13)9-5-10(16)7-11(17)6-9/h3-7H,2H2,1H3,(H2,18,19) |
| InChIKey | NCQZINWCCQEQKQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine?
The IUPAC name of 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine (CID 79975298) is 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine.
What is the SMILES notation for 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine?
The canonical SMILES for 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine is CCc1ccsc1-c1onc(N)c1-c1cc(F)cc(F)c1.
What is the InChIKey of 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine?
The InChIKey is NCQZINWCCQEQKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2OS/c1-2-8-3-4-21-14(8)13-12(15(18)19-20-13)9-5-10(16)7-11(17)6-9/h3-7H,2H2,1H3,(H2,18,19).
What are the key properties of 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine?
4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine has a molecular weight of 306.34 g/mol, XLogP of 4.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-difluorophenyl)-5-(3-ethylthiophen-2-yl)-1,2-oxazol-3-amine is sourced from PubChem (CID 79975298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).