C15H19Br — CID 79976856
1-[2-(bromomethyl)-3-methylbut-1-enyl]-4-cyclopropylbenzene (PubChem CID 79976856) has the molecular formula C15H19Br and a molecular weight of 279.22 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-methylbut-1-enyl]-4-cyclopropylbenzene.
| Compound Name | 1-[2-(bromomethyl)-3-methylbut-1-enyl]-4-cyclopropylbenzene |
|---|---|
| PubChem CID | 79976856 |
| Molecular Formula | C15H19Br |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 1-[2-(bromomethyl)-3-methylbut-1-enyl]-4-cyclopropylbenzene |
| SMILES | CC(C)C(=Cc1ccc(C2CC2)cc1)CBr |
| InChI | InChI=1S/C15H19Br/c1-11(2)15(10-16)9-12-3-5-13(6-4-12)14-7-8-14/h3-6,9,11,14H,7-8,10H2,1-2H3 |
| InChIKey | FKATVDWQIZRCJR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|