C15H15BrOS — CID 79980644
2-(4-bromothiophen-2-yl)-1-(3-cyclopropylphenyl)ethanol (PubChem CID 79980644) has the molecular formula C15H15BrOS and a molecular weight of 323.26 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(3-cyclopropylphenyl)ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(3-cyclopropylphenyl)ethanol |
|---|---|
| PubChem CID | 79980644 |
| Molecular Formula | C15H15BrOS |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(3-cyclopropylphenyl)ethanol |
| SMILES | OC(Cc1cc(Br)cs1)c1cccc(C2CC2)c1 |
| InChI | InChI=1S/C15H15BrOS/c16-13-7-14(18-9-13)8-15(17)12-3-1-2-11(6-12)10-4-5-10/h1-3,6-7,9-10,15,17H,4-5,8H2 |
| InChIKey | KPLDTJYIRRLXKM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |