C16H21NO2 — CID 79982598
1-[(2-cyclopropylphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 79982598) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-[(2-cyclopropylphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(2-cyclopropylphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 79982598 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1-[(2-cyclopropylphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(Cc2ccccc2C2CC2)CC1 |
| InChI | InChI=1S/C16H21NO2/c18-16(19)13-7-9-17(10-8-13)11-14-3-1-2-4-15(14)12-5-6-12/h1-4,12-13H,5-11H2,(H,18,19) |
| InChIKey | CNOKKALDVLGPLI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |