C28H36N2O4 — CID 175535034
1-[[4-[1-(2-cyclopropylphenyl)azetidin-3-yl]-2,6-dimethylphenyl]methyl]piperidine-4-carboxylic acid;formic acid (PubChem CID 175535034) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 1-[[4-[1-(2-cyclopropylphenyl)azetidin-3-yl]-2,6-dimethylphenyl]methyl]piperidine-4-carboxylic acid;formic acid.
| Compound Name | 1-[[4-[1-(2-cyclopropylphenyl)azetidin-3-yl]-2,6-dimethylphenyl]methyl]piperidine-4-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 175535034 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 1-[[4-[1-(2-cyclopropylphenyl)azetidin-3-yl]-2,6-dimethylphenyl]methyl]piperidine-4-carboxylic acid;formic acid |
| SMILES | Cc1cc(C2CN(c3ccccc3C3CC3)C2)cc(C)c1CN1CCC(C(=O)O)CC1.O=CO |
| InChI | InChI=1S/C27H34N2O2.CH2O2/c1-18-13-22(14-19(2)25(18)17-28-11-9-21(10-12-28)27(30)31)23-15-29(16-23)26-6-4-3-5-24(26)20-7-8-20;2-1-3/h3-6,13-14,20-21,23H,7-12,15-17H2,1-2H3,(H,30,31);1H,(H,2,3) |
| InChIKey | JUBHWRZSUZNGPU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|