C17H16Cl2O — CID 79983379
1-(2-cyclopropylphenyl)-2-(3,4-dichlorophenyl)ethanol (PubChem CID 79983379) has the molecular formula C17H16Cl2O and a molecular weight of 307.22 g/mol. Its IUPAC name is 1-(2-cyclopropylphenyl)-2-(3,4-dichlorophenyl)ethanol.
| Compound Name | 1-(2-cyclopropylphenyl)-2-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 79983379 |
| Molecular Formula | C17H16Cl2O |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 1-(2-cyclopropylphenyl)-2-(3,4-dichlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)c(Cl)c1)c1ccccc1C1CC1 |
| InChI | InChI=1S/C17H16Cl2O/c18-15-8-5-11(9-16(15)19)10-17(20)14-4-2-1-3-13(14)12-6-7-12/h1-5,8-9,12,17,20H,6-7,10H2 |
| InChIKey | QWQLBHUKXILQPV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |