About 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide
2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide (PubChem CID 79986456) has the molecular formula C18H31NO
and a molecular weight of 277.45 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide |
| PubChem CID | 79986456 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H31NO/c1-13(2)9-19-15(20)8-18-7-14-5-16(3,11-18)10-17(4,6-14)12-18/h13-14H,5-12H2,1-4H3,(H,19,20) |
| InChIKey | ORMPTAVSJHDIMX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide?
The IUPAC name of 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide (CID 79986456) is 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide.
What is the SMILES notation for 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide?
The canonical SMILES for 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide is CC(C)CNC(=O)CC12CC3CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide?
The InChIKey is ORMPTAVSJHDIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO/c1-13(2)9-19-15(20)8-18-7-14-5-16(3,11-18)10-17(4,6-14)12-18/h13-14H,5-12H2,1-4H3,(H,19,20).
What are the key properties of 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide?
2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide has a molecular weight of 277.45 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1-adamantyl)-N-(2-methylpropyl)acetamide is sourced from PubChem (CID 79986456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).