C18H26ClNS — CID 79988041
2-(1-adamantyl)-1-(5-chlorothiophen-2-yl)-N-ethylethanamine (PubChem CID 79988041) has the molecular formula C18H26ClNS and a molecular weight of 323.93 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-(5-chlorothiophen-2-yl)-N-ethylethanamine.
| Compound Name | 2-(1-adamantyl)-1-(5-chlorothiophen-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 79988041 |
| Molecular Formula | C18H26ClNS |
| Molecular Weight | 323.93 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-(1-adamantyl)-1-(5-chlorothiophen-2-yl)-N-ethylethanamine |
| SMILES | CCNC(CC12CC3CC(CC(C3)C1)C2)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H26ClNS/c1-2-20-15(16-3-4-17(19)21-16)11-18-8-12-5-13(9-18)7-14(6-12)10-18/h3-4,12-15,20H,2,5-11H2,1H3 |
| InChIKey | UOBGQHJYBCIBFP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |