C17H23Cl2NS — CID 79988914
2-(1-adamantyl)-1-(2,5-dichlorothiophen-3-yl)-N-methylethanamine (PubChem CID 79988914) has the molecular formula C17H23Cl2NS and a molecular weight of 344.35 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-(2,5-dichlorothiophen-3-yl)-N-methylethanamine.
| Compound Name | 2-(1-adamantyl)-1-(2,5-dichlorothiophen-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 79988914 |
| Molecular Formula | C17H23Cl2NS |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-(1-adamantyl)-1-(2,5-dichlorothiophen-3-yl)-N-methylethanamine |
| SMILES | CNC(CC12CC3CC(CC(C3)C1)C2)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C17H23Cl2NS/c1-20-14(13-5-15(18)21-16(13)19)9-17-6-10-2-11(7-17)4-12(3-10)8-17/h5,10-12,14,20H,2-4,6-9H2,1H3 |
| InChIKey | LFPJIZVCROWZPD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |