C15H25NS2 — CID 79988667
2-cyclohexylsulfanyl-N-ethyl-1-(3-methylthiophen-2-yl)ethanamine (PubChem CID 79988667) has the molecular formula C15H25NS2 and a molecular weight of 283.51 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N-ethyl-1-(3-methylthiophen-2-yl)ethanamine.
| Compound Name | 2-cyclohexylsulfanyl-N-ethyl-1-(3-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 79988667 |
| Molecular Formula | C15H25NS2 |
| Molecular Weight | 283.51 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-cyclohexylsulfanyl-N-ethyl-1-(3-methylthiophen-2-yl)ethanamine |
| SMILES | CCNC(CSC1CCCCC1)c1sccc1C |
| InChI | InChI=1S/C15H25NS2/c1-3-16-14(15-12(2)9-10-17-15)11-18-13-7-5-4-6-8-13/h9-10,13-14,16H,3-8,11H2,1-2H3 |
| InChIKey | PNIJYDCETHCXLZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |