C13H15Br2NS2 — CID 79992101
N-[(5-bromo-4-methylthiophen-2-yl)-(3-bromothiophen-2-yl)methyl]propan-1-amine (PubChem CID 79992101) has the molecular formula C13H15Br2NS2 and a molecular weight of 409.21 g/mol. Its IUPAC name is N-[(5-bromo-4-methylthiophen-2-yl)-(3-bromothiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromo-4-methylthiophen-2-yl)-(3-bromothiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79992101 |
| Molecular Formula | C13H15Br2NS2 |
| Molecular Weight | 409.21 g/mol |
| Exact Mass | 406.90 |
| IUPAC Name | N-[(5-bromo-4-methylthiophen-2-yl)-(3-bromothiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(C)c(Br)s1)c1sccc1Br |
| InChI | InChI=1S/C13H15Br2NS2/c1-3-5-16-11(12-9(14)4-6-17-12)10-7-8(2)13(15)18-10/h4,6-7,11,16H,3,5H2,1-2H3 |
| InChIKey | CUYJRMWDGNGXIL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.21 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |