C15H17BrFNS — CID 81277844
N-[(3-bromothiophen-2-yl)-(4-fluoro-2-methylphenyl)methyl]propan-1-amine (PubChem CID 81277844) has the molecular formula C15H17BrFNS and a molecular weight of 342.28 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)-(4-fluoro-2-methylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromothiophen-2-yl)-(4-fluoro-2-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 81277844 |
| Molecular Formula | C15H17BrFNS |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)-(4-fluoro-2-methylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(F)cc1C)c1sccc1Br |
| InChI | InChI=1S/C15H17BrFNS/c1-3-7-18-14(15-13(16)6-8-19-15)12-5-4-11(17)9-10(12)2/h4-6,8-9,14,18H,3,7H2,1-2H3 |
| InChIKey | TZENHNCGLWJBKD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |