C18H29N3 — CID 79995661
(3,5-dimethyl-1-adamantyl)-(1-ethylpyrazol-4-yl)methanamine (PubChem CID 79995661) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is (3,5-dimethyl-1-adamantyl)-(1-ethylpyrazol-4-yl)methanamine.
| Compound Name | (3,5-dimethyl-1-adamantyl)-(1-ethylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 79995661 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (3,5-dimethyl-1-adamantyl)-(1-ethylpyrazol-4-yl)methanamine |
| SMILES | CCn1cc(C(N)C23CC4CC(C)(CC(C)(C4)C2)C3)cn1 |
| InChI | InChI=1S/C18H29N3/c1-4-21-9-14(8-20-21)15(19)18-7-13-5-16(2,11-18)10-17(3,6-13)12-18/h8-9,13,15H,4-7,10-12,19H2,1-3H3 |
| InChIKey | IZROQDXXGMFNNO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |