C17H23Br2NS — CID 80533489
(4,5-dibromothiophen-2-yl)-(3,5-dimethyl-1-adamantyl)methanamine (PubChem CID 80533489) has the molecular formula C17H23Br2NS and a molecular weight of 433.25 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(3,5-dimethyl-1-adamantyl)methanamine.
| Compound Name | (4,5-dibromothiophen-2-yl)-(3,5-dimethyl-1-adamantyl)methanamine |
|---|---|
| PubChem CID | 80533489 |
| Molecular Formula | C17H23Br2NS |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(3,5-dimethyl-1-adamantyl)methanamine |
| SMILES | CC12CC3CC(C)(C1)CC(C(N)c1cc(Br)c(Br)s1)(C3)C2 |
| InChI | InChI=1S/C17H23Br2NS/c1-15-4-10-5-16(2,7-15)9-17(6-10,8-15)13(20)12-3-11(18)14(19)21-12/h3,10,13H,4-9,20H2,1-2H3 |
| InChIKey | MRRWXEIATODVOB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |