C17H21Br2ClS — CID 102837057
3-bromo-5-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-2-chlorothiophene (PubChem CID 102837057) has the molecular formula C17H21Br2ClS and a molecular weight of 452.68 g/mol. Its IUPAC name is 3-bromo-5-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-2-chlorothiophene.
| Compound Name | 3-bromo-5-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-2-chlorothiophene |
|---|---|
| PubChem CID | 102837057 |
| Molecular Formula | C17H21Br2ClS |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | 3-bromo-5-[bromo-(3,5-dimethyl-1-adamantyl)methyl]-2-chlorothiophene |
| SMILES | CC12CC3CC(C)(C1)CC(C(Br)c1cc(Br)c(Cl)s1)(C3)C2 |
| InChI | InChI=1S/C17H21Br2ClS/c1-15-4-10-5-16(2,7-15)9-17(6-10,8-15)13(19)12-3-11(18)14(20)21-12/h3,10,13H,4-9H2,1-2H3 |
| InChIKey | DCFYXUOOAOSPEA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|