C17H21BrCl2S — CID 102836571
3-bromo-2-chloro-5-[chloro-(3,5-dimethyl-1-adamantyl)methyl]thiophene (PubChem CID 102836571) has the molecular formula C17H21BrCl2S and a molecular weight of 408.23 g/mol. Its IUPAC name is 3-bromo-2-chloro-5-[chloro-(3,5-dimethyl-1-adamantyl)methyl]thiophene.
| Compound Name | 3-bromo-2-chloro-5-[chloro-(3,5-dimethyl-1-adamantyl)methyl]thiophene |
|---|---|
| PubChem CID | 102836571 |
| Molecular Formula | C17H21BrCl2S |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 3-bromo-2-chloro-5-[chloro-(3,5-dimethyl-1-adamantyl)methyl]thiophene |
| SMILES | CC12CC3CC(C)(C1)CC(C(Cl)c1cc(Br)c(Cl)s1)(C3)C2 |
| InChI | InChI=1S/C17H21BrCl2S/c1-15-4-10-5-16(2,7-15)9-17(6-10,8-15)13(19)12-3-11(18)14(20)21-12/h3,10,13H,4-9H2,1-2H3 |
| InChIKey | QAYSSYFROOBTFN-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|