C15H20BrNOS — CID 79997853
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-bromo-4-methylthiophene-2-carboxamide (PubChem CID 79997853) has the molecular formula C15H20BrNOS and a molecular weight of 342.30 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-bromo-4-methylthiophene-2-carboxamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-bromo-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79997853 |
| Molecular Formula | C15H20BrNOS |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-bromo-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)C2CC3CCC2C3)sc1Br |
| InChI | InChI=1S/C15H20BrNOS/c1-8-5-13(19-14(8)16)15(18)17-9(2)12-7-10-3-4-11(12)6-10/h5,9-12H,3-4,6-7H2,1-2H3,(H,17,18) |
| InChIKey | OUPNJWUGVAKWOJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |