C17H25ClN2O — CID 120616369
5-amino-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-methylbenzamide;hydrochloride (PubChem CID 120616369) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 5-amino-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-methylbenzamide;hydrochloride.
| Compound Name | 5-amino-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120616369 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 5-amino-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-methylbenzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NC(C)C1CC2CCC1C2.Cl |
| InChI | InChI=1S/C17H24N2O.ClH/c1-10-3-6-14(18)9-15(10)17(20)19-11(2)16-8-12-4-5-13(16)7-12;/h3,6,9,11-13,16H,4-5,7-8,18H2,1-2H3,(H,19,20);1H |
| InChIKey | JQEWPMRBTPIQNK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|