C18H25ClS — CID 79999327
2-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]thiophene (PubChem CID 79999327) has the molecular formula C18H25ClS and a molecular weight of 308.92 g/mol. Its IUPAC name is 2-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]thiophene.
| Compound Name | 2-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]thiophene |
|---|---|
| PubChem CID | 79999327 |
| Molecular Formula | C18H25ClS |
| Molecular Weight | 308.92 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]thiophene |
| SMILES | CC12CC3CC(C)(C1)CC(C(Cl)Cc1cccs1)(C3)C2 |
| InChI | InChI=1S/C18H25ClS/c1-16-7-13-8-17(2,10-16)12-18(9-13,11-16)15(19)6-14-4-3-5-20-14/h3-5,13,15H,6-12H2,1-2H3 |
| InChIKey | WYUNHFCDGROFFT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.92 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|