C19H27F2N2O+ — CID 8001355
2,4-difluoro-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]benzamide (PubChem CID 8001355) has the molecular formula C19H27F2N2O+ and a molecular weight of 337.43 g/mol. Its IUPAC name is 2,4-difluoro-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]benzamide.
| Compound Name | 2,4-difluoro-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 8001355 |
| Molecular Formula | C19H27F2N2O+ |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 2,4-difluoro-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1([NH+]2CCCCC2)CCCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H26F2N2O/c20-15-7-8-16(17(21)13-15)18(24)22-14-19(9-3-1-4-10-19)23-11-5-2-6-12-23/h7-8,13H,1-6,9-12,14H2,(H,22,24)/p+1 |
| InChIKey | DCILHAOJRSPDGT-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |