C18H14N6OS — CID 8005181
1-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 8005181) has the molecular formula C18H14N6OS and a molecular weight of 362.42 g/mol. Its IUPAC name is 1-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 8005181 |
| Molecular Formula | C18H14N6OS |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nccs1)Nc1cn(-c2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C18H14N6OS/c25-17(22-18-20-9-10-26-18)21-15-12-24(14-6-2-1-3-7-14)23-16(15)13-5-4-8-19-11-13/h1-12H,(H2,20,21,22,25) |
| InChIKey | JVLAYHYKYJTKBW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |