C23H20N4O — CID 8714286
N-(2,3-dimethylphenyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide (PubChem CID 8714286) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 8714286 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(2,3-dimethylphenyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cn(-c3ccccc3)nc2-c2cccnc2)c1C |
| InChI | InChI=1S/C23H20N4O/c1-16-8-6-12-21(17(16)2)25-23(28)20-15-27(19-10-4-3-5-11-19)26-22(20)18-9-7-13-24-14-18/h3-15H,1-2H3,(H,25,28) |
| InChIKey | YDPQONQEZVGMBO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |