C15H26N2O2 — CID 800535
N-[2-(cyclohexylamino)-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 800535) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(cyclohexylamino)-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 800535 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | N-[2-(cyclohexylamino)-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C15H26N2O2/c18-14(17-13-9-5-2-6-10-13)11-16-15(19)12-7-3-1-4-8-12/h12-13H,1-11H2,(H,16,19)(H,17,18) |
| InChIKey | PHPDRDGUPXRXHI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |