C20H19NO5S — CID 8005655
2-(4-methoxyphenoxy)ethyl 4-(1,3-thiazol-4-ylmethoxy)benzoate (PubChem CID 8005655) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 4-(1,3-thiazol-4-ylmethoxy)benzoate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 4-(1,3-thiazol-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 8005655 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 4-(1,3-thiazol-4-ylmethoxy)benzoate |
| SMILES | COc1ccc(OCCOC(=O)c2ccc(OCc3cscn3)cc2)cc1 |
| InChI | InChI=1S/C20H19NO5S/c1-23-17-6-8-18(9-7-17)24-10-11-25-20(22)15-2-4-19(5-3-15)26-12-16-13-27-14-21-16/h2-9,13-14H,10-12H2,1H3 |
| InChIKey | KUGIMKSLYKYQHM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|