C19H13ClN2O2 — CID 8006377
7-chloro-3-methyl-N-quinolin-2-yl-1-benzofuran-2-carboxamide (PubChem CID 8006377) has the molecular formula C19H13ClN2O2 and a molecular weight of 336.78 g/mol. Its IUPAC name is 7-chloro-3-methyl-N-quinolin-2-yl-1-benzofuran-2-carboxamide.
| Compound Name | 7-chloro-3-methyl-N-quinolin-2-yl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8006377 |
| Molecular Formula | C19H13ClN2O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 7-chloro-3-methyl-N-quinolin-2-yl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc3ccccc3n2)oc2c(Cl)cccc12 |
| InChI | InChI=1S/C19H13ClN2O2/c1-11-13-6-4-7-14(20)18(13)24-17(11)19(23)22-16-10-9-12-5-2-3-8-15(12)21-16/h2-10H,1H3,(H,21,22,23) |
| InChIKey | HLUKEMCDUYFCJV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |