C14H24N4O2+2 — CID 8007589
[4-[2-(4-methoxyphenoxy)ethyl]piperazine-1,4-diium-1-ylidene]methanediamine (PubChem CID 8007589) has the molecular formula C14H24N4O2+2 and a molecular weight of 280.37 g/mol. Its IUPAC name is [4-[2-(4-methoxyphenoxy)ethyl]piperazine-1,4-diium-1-ylidene]methanediamine.
| Compound Name | [4-[2-(4-methoxyphenoxy)ethyl]piperazine-1,4-diium-1-ylidene]methanediamine |
|---|---|
| PubChem CID | 8007589 |
| Molecular Formula | C14H24N4O2+2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [4-[2-(4-methoxyphenoxy)ethyl]piperazine-1,4-diium-1-ylidene]methanediamine |
| SMILES | COc1ccc(OCC[NH+]2CC[N+](=C(N)N)CC2)cc1 |
| InChI | InChI=1S/C14H22N4O2/c1-19-12-2-4-13(5-3-12)20-11-10-17-6-8-18(9-7-17)14(15)16/h2-5H,6-11H2,1H3,(H3,15,16)/p+2 |
| InChIKey | XNSAJWWBGSWAFS-UHFFFAOYSA-P |
| XLogP | -1.74 |
| TPSA | 77.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|