C20H20N2O6S — CID 8013449
[2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] 3,4,5-trimethoxybenzoate (PubChem CID 8013449) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 8013449 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2ccc(SC#N)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N2O6S/c1-12-7-14(29-11-21)5-6-15(12)22-18(23)10-28-20(24)13-8-16(25-2)19(27-4)17(9-13)26-3/h5-9H,10H2,1-4H3,(H,22,23) |
| InChIKey | WIOHPHZVJNSFOJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|