C20H20FN3OS2 — CID 8015493
(2R)-N-[4-(dimethylamino)phenyl]-2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]propanamide (PubChem CID 8015493) has the molecular formula C20H20FN3OS2 and a molecular weight of 401.53 g/mol. Its IUPAC name is (2R)-N-[4-(dimethylamino)phenyl]-2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[4-(dimethylamino)phenyl]-2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 8015493 |
| Molecular Formula | C20H20FN3OS2 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (2R)-N-[4-(dimethylamino)phenyl]-2-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1nc(-c2ccc(F)cc2)cs1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H20FN3OS2/c1-13(19(25)22-16-8-10-17(11-9-16)24(2)3)27-20-23-18(12-26-20)14-4-6-15(21)7-5-14/h4-13H,1-3H3,(H,22,25)/t13-/m1/s1 |
| InChIKey | LWLSDPUQZXVTJN-CYBMUJFWSA-N |
| XLogP | 5.13 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|