C23H24N2O2S — CID 8016895
(3S,7aR)-N-(2,3-dihydro-1H-inden-5-yl)-7a-(4-methylphenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 8016895) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is (3S,7aR)-N-(2,3-dihydro-1H-inden-5-yl)-7a-(4-methylphenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aR)-N-(2,3-dihydro-1H-inden-5-yl)-7a-(4-methylphenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 8016895 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (3S,7aR)-N-(2,3-dihydro-1H-inden-5-yl)-7a-(4-methylphenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | Cc1ccc([C@]23CCC(=O)N2[C@@H](C(=O)Nc2ccc4c(c2)CCC4)CS3)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-15-5-8-18(9-6-15)23-12-11-21(26)25(23)20(14-28-23)22(27)24-19-10-7-16-3-2-4-17(16)13-19/h5-10,13,20H,2-4,11-12,14H2,1H3,(H,24,27)/t20-,23-/m1/s1 |
| InChIKey | JFGFLXINNYAKLZ-NFBKMPQASA-N |
| XLogP | 4.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |