C20H25BrN2O2S — CID 25499489
(3R,7aR)-7a-(4-bromophenyl)-N-cycloheptyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 25499489) has the molecular formula C20H25BrN2O2S and a molecular weight of 437.40 g/mol. Its IUPAC name is (3R,7aR)-7a-(4-bromophenyl)-N-cycloheptyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3R,7aR)-7a-(4-bromophenyl)-N-cycloheptyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 25499489 |
| Molecular Formula | C20H25BrN2O2S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (3R,7aR)-7a-(4-bromophenyl)-N-cycloheptyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | O=C(NC1CCCCCC1)[C@@H]1CS[C@@]2(c3ccc(Br)cc3)CCC(=O)N12 |
| InChI | InChI=1S/C20H25BrN2O2S/c21-15-9-7-14(8-10-15)20-12-11-18(24)23(20)17(13-26-20)19(25)22-16-5-3-1-2-4-6-16/h7-10,16-17H,1-6,11-13H2,(H,22,25)/t17-,20+/m0/s1 |
| InChIKey | VZLFLCYDIVDINN-FXAWDEMLSA-N |
| XLogP | 4.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |