C14H14BrNO3S — CID 40844692
methyl (3S,7aS)-7a-(4-bromophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 40844692) has the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. Its IUPAC name is methyl (3S,7aS)-7a-(4-bromophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | methyl (3S,7aS)-7a-(4-bromophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 40844692 |
| Molecular Formula | C14H14BrNO3S |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | methyl (3S,7aS)-7a-(4-bromophenyl)-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | COC(=O)[C@H]1CS[C@]2(c3ccc(Br)cc3)CCC(=O)N12 |
| InChI | InChI=1S/C14H14BrNO3S/c1-19-13(18)11-8-20-14(7-6-12(17)16(11)14)9-2-4-10(15)5-3-9/h2-5,11H,6-8H2,1H3/t11-,14+/m1/s1 |
| InChIKey | YIDFRGXEWHMEDS-RISCZKNCSA-N |
| XLogP | 2.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |