C17H21N2O6S- — CID 8022586
3-[[(3S)-1-(4-acetylphenyl)sulfonylpiperidine-3-carbonyl]amino]propanoate (PubChem CID 8022586) has the molecular formula C17H21N2O6S- and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[[(3S)-1-(4-acetylphenyl)sulfonylpiperidine-3-carbonyl]amino]propanoate.
| Compound Name | 3-[[(3S)-1-(4-acetylphenyl)sulfonylpiperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 8022586 |
| Molecular Formula | C17H21N2O6S- |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-[[(3S)-1-(4-acetylphenyl)sulfonylpiperidine-3-carbonyl]amino]propanoate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC[C@H](C(=O)NCCC(=O)[O-])C2)cc1 |
| InChI | InChI=1S/C17H22N2O6S/c1-12(20)13-4-6-15(7-5-13)26(24,25)19-10-2-3-14(11-19)17(23)18-9-8-16(21)22/h4-7,14H,2-3,8-11H2,1H3,(H,18,23)(H,21,22)/p-1/t14-/m0/s1 |
| InChIKey | SYBRRWSVQFCJOQ-AWEZNQCLSA-M |
| XLogP | -0.45 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |