C17H26N3O+ — CID 8022870
N-[(Z)-(2-methyl-1-phenylpropylidene)amino]-2-piperidin-1-ium-1-ylacetamide (PubChem CID 8022870) has the molecular formula C17H26N3O+ and a molecular weight of 288.41 g/mol. Its IUPAC name is N-[(Z)-(2-methyl-1-phenylpropylidene)amino]-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-[(Z)-(2-methyl-1-phenylpropylidene)amino]-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 8022870 |
| Molecular Formula | C17H26N3O+ |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | N-[(Z)-(2-methyl-1-phenylpropylidene)amino]-2-piperidin-1-ium-1-ylacetamide |
| SMILES | CC(C)/C(=N/NC(=O)C[NH+]1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H25N3O/c1-14(2)17(15-9-5-3-6-10-15)19-18-16(21)13-20-11-7-4-8-12-20/h3,5-6,9-10,14H,4,7-8,11-13H2,1-2H3,(H,18,21)/p+1/b19-17- |
| InChIKey | UPNZVTXCSKORAJ-ZPHPHTNESA-O |
| XLogP | 1.23 |
| TPSA | 45.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|