C23H18N4S — CID 8024255
3-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]-1H-benzimidazole-2-thione (PubChem CID 8024255) has the molecular formula C23H18N4S and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]-1H-benzimidazole-2-thione.
| Compound Name | 3-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 8024255 |
| Molecular Formula | C23H18N4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc(-n2nc(-c3ccccc3)cc2-n2c(=S)[nH]c3ccccc32)cc1 |
| InChI | InChI=1S/C23H18N4S/c1-16-11-13-18(14-12-16)27-22(15-20(25-27)17-7-3-2-4-8-17)26-21-10-6-5-9-19(21)24-23(26)28/h2-15H,1H3,(H,24,28) |
| InChIKey | NPYZLBBYJLEUOW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|