C15H14N2S — CID 82088501
3-(2,6-dimethylphenyl)-1H-benzimidazole-2-thione (PubChem CID 82088501) has the molecular formula C15H14N2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1H-benzimidazole-2-thione.
| Compound Name | 3-(2,6-dimethylphenyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 82088501 |
| Molecular Formula | C15H14N2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1H-benzimidazole-2-thione |
| SMILES | Cc1cccc(C)c1-n1c(=S)[nH]c2ccccc21 |
| InChI | InChI=1S/C15H14N2S/c1-10-6-5-7-11(2)14(10)17-13-9-4-3-8-12(13)16-15(17)18/h3-9H,1-2H3,(H,16,18) |
| InChIKey | MUVVYXVIJFXGMF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|