C17H22N2S — CID 70803410
3-[(5S)-4,5-dimethyl-5-propan-2-ylcyclopenten-1-yl]-1H-benzimidazole-2-thione (PubChem CID 70803410) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 3-[(5S)-4,5-dimethyl-5-propan-2-ylcyclopenten-1-yl]-1H-benzimidazole-2-thione.
| Compound Name | 3-[(5S)-4,5-dimethyl-5-propan-2-ylcyclopenten-1-yl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 70803410 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-[(5S)-4,5-dimethyl-5-propan-2-ylcyclopenten-1-yl]-1H-benzimidazole-2-thione |
| SMILES | CC(C)[C@]1(C)C(n2c(=S)[nH]c3ccccc32)=CCC1C |
| InChI | InChI=1S/C17H22N2S/c1-11(2)17(4)12(3)9-10-15(17)19-14-8-6-5-7-13(14)18-16(19)20/h5-8,10-12H,9H2,1-4H3,(H,18,20)/t12?,17-/m0/s1 |
| InChIKey | BFBZPTOUJNDWLJ-TYJDENFWSA-N |
| XLogP | 5.24 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|