C23H28N4O+2 — CID 8024834
3-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylazaniumyl]propyl-dimethylazanium (PubChem CID 8024834) has the molecular formula C23H28N4O+2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylazaniumyl]propyl-dimethylazanium.
| Compound Name | 3-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylazaniumyl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 8024834 |
| Molecular Formula | C23H28N4O+2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 3-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylazaniumyl]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCC[NH2+]Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H26N4O/c1-26(2)14-8-13-24-16-19-17-27(20-10-4-3-5-11-20)25-23(19)22-15-18-9-6-7-12-21(18)28-22/h3-7,9-12,15,17,24H,8,13-14,16H2,1-2H3/p+2 |
| InChIKey | HMAVCDJMIVNSAW-UHFFFAOYSA-P |
| XLogP | 1.88 |
| TPSA | 52.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|