C17H14ClN3OS — CID 802746
2-(2-chloroanilino)-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 802746) has the molecular formula C17H14ClN3OS and a molecular weight of 343.84 g/mol. Its IUPAC name is 2-(2-chloroanilino)-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2-chloroanilino)-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 802746 |
| Molecular Formula | C17H14ClN3OS |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-(2-chloroanilino)-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ccccc2Cl)sc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H14ClN3OS/c1-11-15(16(22)20-12-7-3-2-4-8-12)23-17(19-11)21-14-10-6-5-9-13(14)18/h2-10H,1H3,(H,19,21)(H,20,22) |
| InChIKey | ZNJQLQFSGFJYSO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |