About (-)-2-Aminobutyric acid
(-)-2-Aminobutyric acid (PubChem CID 80283) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is (2S)-2-aminobutanoic acid.
Molecular Properties
| Compound Name | (-)-2-Aminobutyric acid |
| PubChem CID | 80283 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | (2S)-2-aminobutanoic acid |
| SMILES | CC[C@@H](C(=O)O)N |
| InChI | InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | QWCKQJZIFLGMSD-VKHMYHEASA-N |
| XLogP | -2.50 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | 72 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (-)-2-Aminobutyric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (-)-2-Aminobutyric acid?
The IUPAC name of (-)-2-Aminobutyric acid (CID 80283) is (2S)-2-aminobutanoic acid.
What is the SMILES notation for (-)-2-Aminobutyric acid?
The canonical SMILES for (-)-2-Aminobutyric acid is CC[C@@H](C(=O)O)N.
What is the InChIKey of (-)-2-Aminobutyric acid?
The InChIKey is QWCKQJZIFLGMSD-VKHMYHEASA-N. The full InChI is InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1.
What are the key properties of (-)-2-Aminobutyric acid?
(-)-2-Aminobutyric acid has a molecular weight of 103.12 g/mol, XLogP of -2.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (-)-2-Aminobutyric acid is sourced from PubChem (CID 80283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).