2-aminopropanoic acid

C3H7NO2 — CID 602

IUPAC2-aminopropanoic acid
SMILESCC(N)C(=O)O
InChIInChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)
InChIKeyQNAYBMKLOCPYGJ-UHFFFAOYSA-N
MW89.09 g/mol
LogP-0.58
Rot. Bonds1

About 2-aminopropanoic acid

2-aminopropanoic acid (PubChem CID 602) has the molecular formula C3H7NO2 and a molecular weight of 89.09 g/mol. Its IUPAC name is 2-aminopropanoic acid.

Molecular Properties

Compound Name2-aminopropanoic acid
PubChem CID602
Molecular FormulaC3H7NO2
Molecular Weight89.09 g/mol
Exact Mass89.05
IUPAC Name2-aminopropanoic acid
SMILESCC(N)C(=O)O
InChIInChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)
InChIKeyQNAYBMKLOCPYGJ-UHFFFAOYSA-N
XLogP-0.58
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms6
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50089.09
LogP ≤ 5-0.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-aminopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminopropanoic acid?
The IUPAC name of 2-aminopropanoic acid (CID 602) is 2-aminopropanoic acid.
What is the SMILES notation for 2-aminopropanoic acid?
The canonical SMILES for 2-aminopropanoic acid is CC(N)C(=O)O.
What is the InChIKey of 2-aminopropanoic acid?
The InChIKey is QNAYBMKLOCPYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6).
What are the key properties of 2-aminopropanoic acid?
2-aminopropanoic acid has a molecular weight of 89.09 g/mol, XLogP of -0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanoic acid is sourced from PubChem (CID 602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).