About Alpha-Aminobutyric Acid
Alpha-Aminobutyric Acid (PubChem CID 6657) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is 2-aminobutanoic acid.
Molecular Properties
| Compound Name | Alpha-Aminobutyric Acid |
| PubChem CID | 6657 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | 2-aminobutanoic acid |
| SMILES | CCC(C(=O)O)N |
| InChI | InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| InChIKey | QWCKQJZIFLGMSD-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | 72 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Alpha-Aminobutyric Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Alpha-Aminobutyric Acid?
The IUPAC name of Alpha-Aminobutyric Acid (CID 6657) is 2-aminobutanoic acid.
What is the SMILES notation for Alpha-Aminobutyric Acid?
The canonical SMILES for Alpha-Aminobutyric Acid is CCC(C(=O)O)N.
What is the InChIKey of Alpha-Aminobutyric Acid?
The InChIKey is QWCKQJZIFLGMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7).
What are the key properties of Alpha-Aminobutyric Acid?
Alpha-Aminobutyric Acid has a molecular weight of 103.12 g/mol, XLogP of -2.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Alpha-Aminobutyric Acid is sourced from PubChem (CID 6657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).