C12H16N4O5 — CID 802989
1,3-dimethyl-6-[(E)-2-morpholin-4-ylethenyl]-5-nitropyrimidine-2,4-dione (PubChem CID 802989) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is 1,3-dimethyl-6-[(E)-2-morpholin-4-ylethenyl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[(E)-2-morpholin-4-ylethenyl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 802989 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1,3-dimethyl-6-[(E)-2-morpholin-4-ylethenyl]-5-nitropyrimidine-2,4-dione |
| SMILES | Cn1c(/C=C/N2CCOCC2)c([N+](=O)[O-])c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H16N4O5/c1-13-9(3-4-15-5-7-21-8-6-15)10(16(19)20)11(17)14(2)12(13)18/h3-4H,5-8H2,1-2H3/b4-3+ |
| InChIKey | OGEWMPWMXBBFAR-ONEGZZNKSA-N |
| XLogP | -0.70 |
| TPSA | 99.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|