About 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine
4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine (PubChem CID 804956) has the molecular formula C14H15N3OS
and a molecular weight of 273.36 g/mol. Its IUPAC name is 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine |
| PubChem CID | 804956 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc2c(c1)c(-c1csc(N)n1)c(C)n2C |
| InChI | InChI=1S/C14H15N3OS/c1-8-13(11-7-19-14(15)16-11)10-6-9(18-3)4-5-12(10)17(8)2/h4-7H,1-3H3,(H2,15,16) |
| InChIKey | VPDSGUDJGGDJMS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine (CID 804956) is 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine is COc1ccc2c(c1)c(-c1csc(N)n1)c(C)n2C.
What is the InChIKey of 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine?
The InChIKey is VPDSGUDJGGDJMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3OS/c1-8-13(11-7-19-14(15)16-11)10-6-9(18-3)4-5-12(10)17(8)2/h4-7H,1-3H3,(H2,15,16).
What are the key properties of 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine?
4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine has a molecular weight of 273.36 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methoxy-1,2-dimethylindol-3-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 804956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).