C18H26BrNO — CID 80500092
5-(1-bromo-2-ethylhexyl)-3,3-dimethyl-1H-indol-2-one (PubChem CID 80500092) has the molecular formula C18H26BrNO and a molecular weight of 352.32 g/mol. Its IUPAC name is 5-(1-bromo-2-ethylhexyl)-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-(1-bromo-2-ethylhexyl)-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 80500092 |
| Molecular Formula | C18H26BrNO |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 5-(1-bromo-2-ethylhexyl)-3,3-dimethyl-1H-indol-2-one |
| SMILES | CCCCC(CC)C(Br)c1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C18H26BrNO/c1-5-7-8-12(6-2)16(19)13-9-10-15-14(11-13)18(3,4)17(21)20-15/h9-12,16H,5-8H2,1-4H3,(H,20,21) |
| InChIKey | KAYHAPIZHKCZDO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|