C11H14N4 — CID 80503694
3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]aniline (PubChem CID 80503694) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]aniline.
| Compound Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]aniline |
|---|---|
| PubChem CID | 80503694 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]aniline |
| SMILES | Cn1cnnc1CCc1cccc(N)c1 |
| InChI | InChI=1S/C11H14N4/c1-15-8-13-14-11(15)6-5-9-3-2-4-10(12)7-9/h2-4,7-8H,5-6,12H2,1H3 |
| InChIKey | JLTCDSXMGJZBBV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|