C16H26N2O2S — CID 80505534
N-(3-amino-3-phenylpropyl)-1-cyclohexylmethanesulfonamide (PubChem CID 80505534) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is N-(3-amino-3-phenylpropyl)-1-cyclohexylmethanesulfonamide.
| Compound Name | N-(3-amino-3-phenylpropyl)-1-cyclohexylmethanesulfonamide |
|---|---|
| PubChem CID | 80505534 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-(3-amino-3-phenylpropyl)-1-cyclohexylmethanesulfonamide |
| SMILES | NC(CCNS(=O)(=O)CC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H26N2O2S/c17-16(15-9-5-2-6-10-15)11-12-18-21(19,20)13-14-7-3-1-4-8-14/h2,5-6,9-10,14,16,18H,1,3-4,7-8,11-13,17H2 |
| InChIKey | OVIUTBCJGHIDOK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |