C8H12N4OS — CID 80511976
3-[2-hydroxyethyl(methyl)amino]pyridazine-4-carbothioamide (PubChem CID 80511976) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is 3-[2-hydroxyethyl(methyl)amino]pyridazine-4-carbothioamide.
| Compound Name | 3-[2-hydroxyethyl(methyl)amino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511976 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-[2-hydroxyethyl(methyl)amino]pyridazine-4-carbothioamide |
| SMILES | CN(CCO)c1nnccc1C(N)=S |
| InChI | InChI=1S/C8H12N4OS/c1-12(4-5-13)8-6(7(9)14)2-3-10-11-8/h2-3,13H,4-5H2,1H3,(H2,9,14) |
| InChIKey | KWZPYFWBOPJABY-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|